EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H18O15 |
| Net Charge | 0 |
| Average Mass | 498.349 |
| Monoisotopic Mass | 498.06457 |
| SMILES | O=C(O)c1cc(O)c(O)c(OC(=O)c2cc(O)c(OC3OC(C(=O)O)C(O)C(O)C3O)c(O)c2)c1 |
| InChI | InChI=1S/C20H18O15/c21-7-1-5(17(28)29)4-10(11(7)24)33-19(32)6-2-8(22)15(9(23)3-6)34-20-14(27)12(25)13(26)16(35-20)18(30)31/h1-4,12-14,16,20-27H,(H,28,29)(H,30,31) |
| InChIKey | HUQDXJPMUFXASW-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-{4-[(5-carboxy-2,3-dihydroxyphenoxy)carbonyl]-2,6-dihydroxyphenoxy}-3,4,5-trihydroxyoxane-2-carboxylic acid (CHEBI:169458) is a tannin (CHEBI:26848) |
| IUPAC Name |
|---|
| 6-[4-(5-carboxy-2,3-dihydroxyphenoxy)carbonyl-2,6-dihydroxyphenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0128327 | HMDB |