EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H15NO5 |
| Net Charge | 0 |
| Average Mass | 205.210 |
| Monoisotopic Mass | 205.09502 |
| SMILES | CN1C2C(O)CC1(O)C(O)C(O)C2O |
| InChI | InChI=1S/C8H15NO5/c1-9-4-3(10)2-8(9,14)7(13)6(12)5(4)11/h3-7,10-14H,2H2,1H3 |
| InChIKey | XTMAEPUCHRMBTC-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-Methylcalystegine C1 (CHEBI:169415) is a tropane alkaloid (CHEBI:37332) |
| IUPAC Name |
|---|
| 8-methyl-8-azabicyclo[3.2.1]octane-1,2,3,4,6-pentol |
| Manual Xrefs | Databases |
|---|---|
| HMDB0036394 | HMDB |
| 35014138 | ChemSpider |