EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H34O2 |
| Net Charge | 0 |
| Average Mass | 270.457 |
| Monoisotopic Mass | 270.25588 |
| SMILES | CCCCCCCCCCCCC(C)CCC(=O)O |
| InChI | InChI=1S/C17H34O2/c1-3-4-5-6-7-8-9-10-11-12-13-16(2)14-15-17(18)19/h16H,3-15H2,1-2H3,(H,18,19) |
| InChIKey | FWZFPYVAIYYOGZ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-methyl-hexadecanoic acid (CHEBI:169413) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| 4-methylhexadecanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4471720 | ChemSpider |
| LMFA01020198 | LIPID MAPS |