EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:16939 - 3-amino-3-(4-hydroxyphenyl)propanoic acid
| Formula | C9H11NO3 |
| Net Charge | 0 |
| Average Mass | 181.191 |
| Monoisotopic Mass | 181.07389 |
| SMILES | NC(CC(=O)O)c1ccc(O)cc1 |
| InChI | InChI=1S/C9H11NO3/c10-8(5-9(12)13)6-1-3-7(11)4-2-6/h1-4,8,11H,5,10H2,(H,12,13) |
| InChIKey | JYPHNHPXFNEZBR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-amino-3-(4-hydroxyphenyl)propanoic acid (CHEBI:16939) has functional parent propionic acid (CHEBI:30768) |
| 3-amino-3-(4-hydroxyphenyl)propanoic acid (CHEBI:16939) has role bacterial metabolite (CHEBI:76969) |
| 3-amino-3-(4-hydroxyphenyl)propanoic acid (CHEBI:16939) is a β-amino acid (CHEBI:33706) |
| 3-amino-3-(4-hydroxyphenyl)propanoic acid (CHEBI:16939) is conjugate acid of 3-amino-3-(4-hydroxyphenyl)propanoate (CHEBI:19960) |
| 3-amino-3-(4-hydroxyphenyl)propanoic acid (CHEBI:16939) is tautomer of 3-amino-3-(4-hydroxyphenyl)propanoic acid zwitterion (CHEBI:57956) |
| Incoming Relation(s) |
| 3-amino-3-(4-hydroxyphenyl)propanoate (CHEBI:19960) is conjugate base of 3-amino-3-(4-hydroxyphenyl)propanoic acid (CHEBI:16939) |
| 3-amino-3-(4-hydroxyphenyl)propanoic acid zwitterion (CHEBI:57956) is tautomer of 3-amino-3-(4-hydroxyphenyl)propanoic acid (CHEBI:16939) |
| IUPAC Name |
|---|
| 3-amino-3-(4-hydroxyphenyl)propanoic acid |
| Synonyms | Source |
|---|---|
| 3-Amino-3-(4-hydroxyphenyl)propanoate | KEGG COMPOUND |
| beta-Tyrosine | KEGG COMPOUND |
| 3-amino-3-(4-hydroxyphenyl)propionic acid | ChEBI |
| beta-tyrosine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C04368 | KEGG COMPOUND |
| C04368 | KEGG COMPOUND |
| HMDB0003831 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2097074 | Reaxys |
| Citations |
|---|