EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H25N3O8S |
| Net Charge | 0 |
| Average Mass | 407.445 |
| Monoisotopic Mass | 407.13624 |
| SMILES | CSCCC(NC(=O)CCC(NC(=O)CCC(N)C(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C15H25N3O8S/c1-27-7-6-10(15(25)26)18-12(20)5-3-9(14(23)24)17-11(19)4-2-8(16)13(21)22/h8-10H,2-7,16H2,1H3,(H,17,19)(H,18,20)(H,21,22)(H,23,24)(H,25,26) |
| InChIKey | OGZNUDJBIAOLAA-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gamma-L-Glutamyl-gamma-L-glutamyl-L-methionine (CHEBI:169374) is a oligopeptide (CHEBI:25676) |
| IUPAC Name |
|---|
| 2-amino-5-[[1-carboxy-4-[(1-carboxy-3-methylsulanylpropyl)amino]-4-oxobutyl]amino]-5-oxopentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 35014630 | ChemSpider |
| HMDB0038674 | HMDB |