EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H12O14 |
| Net Charge | 0 |
| Average Mass | 488.313 |
| Monoisotopic Mass | 488.02271 |
| SMILES | O=C(O)c1cc(O)c(O)c(O)c1Oc1cc2c(=O)oc3c(O)c(O)cc(C(=O)O)c3c2c(O)c1O |
| InChI | InChI=1S/C21H12O14/c22-7-2-6(20(31)32)17(16(28)12(7)24)34-9-3-5-10(15(27)14(9)26)11-4(19(29)30)1-8(23)13(25)18(11)35-21(5)33/h1-3,22-28H,(H,29,30)(H,31,32) |
| InChIKey | WHFMZZCDPZDROO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-(6-carboxy-2,3,4-trihydroxyphenoxy)-3,4,9,10-tetrahydroxy-6-oxo-6H-benzo[c]chromene-1-carboxylic acid (CHEBI:169368) is a tannin (CHEBI:26848) |
| IUPAC Name |
|---|
| 8-(6-carboxy-2,3,4-trihydroxyphenoxy)-3,4,9,10-tetrahydroxy-6-oxobenzo[c]chromene-1-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 74854043 | ChemSpider |
| HMDB0136073 | HMDB |