EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H14O6 |
| Net Charge | 0 |
| Average Mass | 206.194 |
| Monoisotopic Mass | 206.07904 |
| SMILES | CCOC(=O)C(O)C(O)C(=O)OCC |
| InChI | InChI=1S/C8H14O6/c1-3-13-7(11)5(9)6(10)8(12)14-4-2/h5-6,9-10H,3-4H2,1-2H3 |
| InChIKey | YSAVZVORKRDODB-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Diethyl tartrate (CHEBI:169338) is a 3-hydroxy carboxylic acid (CHEBI:61355) |
| IUPAC Name |
|---|
| diethyl 2,3-dihydroxybutanedioate |
| Manual Xrefs | Databases |
|---|---|
| 104927 | ChemSpider |
| HMDB0033584 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:57968-71-5 | ChemIDplus |