EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H34O7 |
| Net Charge | 0 |
| Average Mass | 590.672 |
| Monoisotopic Mass | 590.23045 |
| SMILES | COc1c(Cc2cc(Cc3ccccc3O)ccc2O)c(O)c(Cc2ccccc2O)c(O)c1C(=O)CCc1ccccc1 |
| InChI | InChI=1S/C37H34O7/c1-44-37-29(22-27-20-24(16-17-32(27)40)19-25-11-5-7-13-30(25)38)35(42)28(21-26-12-6-8-14-31(26)39)36(43)34(37)33(41)18-15-23-9-3-2-4-10-23/h2-14,16-17,20,38-40,42-43H,15,18-19,21-22H2,1H3 |
| InChIKey | MUDLJXNGDNOPHV-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Triuvaretin (CHEBI:169327) is a diarylheptanoid (CHEBI:78802) |
| IUPAC Name |
|---|
| 1-[2,4-dihydroxy-5-[[2-hydroxy-5-[(2-hydroxyphenyl)methyl]phenyl]methyl]-3-[(2-hydroxyphenyl)methyl]-6-methoxyphenyl]-3-phenylpropan-1-one |
| Manual Xrefs | Databases |
|---|---|
| 8161452 | ChemSpider |
| LMPK12120475 | LIPID MAPS |