EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H14O12S |
| Net Charge | 0 |
| Average Mass | 406.321 |
| Monoisotopic Mass | 406.02060 |
| SMILES | COc1cc(/C=C/C(=O)OC(C(=O)O)C(OS(=O)(=O)O)C(=O)O)ccc1O |
| InChI | InChI=1S/C14H14O12S/c1-24-9-6-7(2-4-8(9)15)3-5-10(16)25-11(13(17)18)12(14(19)20)26-27(21,22)23/h2-6,11-12,15H,1H3,(H,17,18)(H,19,20)(H,21,22,23)/b5-3+ |
| InChIKey | XWUODGWCMOMUQU-HWKANZROSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-{[3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxy}-3-(sulfooxy)butanedioic acid (CHEBI:169287) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| 2-[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxy-3-sulooxybutanedioic acid |