EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:169276 - (3xi,6E)-1,7-Diphenyl-6-hepten-3-ol
| Formula | C19H22O |
| Net Charge | 0 |
| Average Mass | 266.384 |
| Monoisotopic Mass | 266.16707 |
| SMILES | OC(CC/C=C\c1ccccc1)CCc1ccccc1 |
| InChI | InChI=1S/C19H22O/c20-19(16-15-18-11-5-2-6-12-18)14-8-7-13-17-9-3-1-4-10-17/h1-7,9-13,19-20H,8,14-16H2/b13-7- |
| InChIKey | DPRCKWANIKZGTF-QPEQYQDCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3xi,6E)-1,7-Diphenyl-6-hepten-3-ol (CHEBI:169276) is a diarylheptanoid (CHEBI:78802) |
| IUPAC Name |
|---|
| (Z)-1,7-diphenylhept-6-en-3-ol |
| Manual Xrefs | Databases |
|---|---|
| HMDB0030146 | HMDB |
| 35013145 | ChemSpider |