EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H46O4 |
| Net Charge | 0 |
| Average Mass | 398.628 |
| Monoisotopic Mass | 398.33961 |
| SMILES | CCCCCC[C@@H](O)C/C=C\CCCCCCC[C@@H](O)CCCCCC(=O)O |
| InChI | InChI=1S/C24H46O4/c1-2-3-4-12-17-22(25)18-13-9-7-5-6-8-10-14-19-23(26)20-15-11-16-21-24(27)28/h9,13,22-23,25-26H,2-8,10-12,14-21H2,1H3,(H,27,28)/b13-9-/t22-,23-/m1/s1 |
| InChIKey | XTSZRMFZUAMBRN-FIIQTUGESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nebraskanic acid (CHEBI:169274) is a very long-chain fatty acid (CHEBI:27283) |
| IUPAC Name |
|---|
| (Z,7R,18R)-7,18-dihydroxytetracos-15-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| LMFA01050558 | LIPID MAPS |