EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H19N3O4S |
| Net Charge | 0 |
| Average Mass | 277.346 |
| Monoisotopic Mass | 277.10963 |
| SMILES | CSCCC(NC(=O)C(N)CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C10H19N3O4S/c1-18-5-4-7(10(16)17)13-9(15)6(11)2-3-8(12)14/h6-7H,2-5,11H2,1H3,(H2,12,14)(H,13,15)(H,16,17) |
| InChIKey | SIGGQAHUPUBWNF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Glutaminylmethionine (CHEBI:169261) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| 2-[(2,5-diamino-5-oxopentanoyl)amino]-4-methylsulanylbutanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 16568305 | ChemSpider |
| HMDB0029155 | HMDB |