EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H14N2O2 |
| Net Charge | 0 |
| Average Mass | 146.190 |
| Monoisotopic Mass | 146.10553 |
| SMILES | CC(N)CCC(N)C(=O)O |
| InChI | InChI=1S/C6H14N2O2/c1-4(7)2-3-5(8)6(9)10/h4-5H,2-3,7-8H2,1H3,(H,9,10) |
| InChIKey | CEVCRLBFUJAKOG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,5-diaminohexanoic acid (CHEBI:16926) has functional parent hexanoic acid (CHEBI:30776) |
| 2,5-diaminohexanoic acid (CHEBI:16926) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| 2,5-diaminohexanoic acid (CHEBI:16926) is conjugate base of 2,5-diammoniohexanoate (CHEBI:57950) |
| Incoming Relation(s) |
| 2,5-diammoniohexanoate (CHEBI:57950) is conjugate acid of 2,5-diaminohexanoic acid (CHEBI:16926) |
| IUPAC Name |
|---|
| 2,5-diaminohexanoic acid |
| Synonym | Source |
|---|---|
| 2,5-Diaminohexanoate | KEGG COMPOUND |