EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H27D3O2 |
| Net Charge | 0 |
| Average Mass | 245.421 |
| Monoisotopic Mass | 245.24341 |
| SMILES | [2H]C([2H])([2H])CCCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C15H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15(16)17/h2-14H2,1H3,(H,16,17)/i1D3 |
| InChIKey | WQEPLUUGTLDZJY-FIBGUPNXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pentadecylic acid(d3) (CHEBI:169232) is a deuterated fatty acid (CHEBI:75427) |
| Pentadecylic acid(d3) (CHEBI:169232) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| 15,15,15-trideuteriopentadecanoic acid |
| Manual Xrefs | Databases |
|---|---|
| LMFA01010045 | LIPID MAPS |
| 24532819 | ChemSpider |