EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:169221 - Norisodomesticine
| Formula | C18H17NO4 |
| Net Charge | 0 |
| Average Mass | 311.337 |
| Monoisotopic Mass | 311.11576 |
| SMILES | [H][C@]12Cc3cc4c(cc3-c3c(OC)c(O)cc(c31)CCN2)OCO4 |
| InChI | InChI=1S/C18H17NO4/c1-21-18-13(20)5-9-2-3-19-12-4-10-6-14-15(23-8-22-14)7-11(10)17(18)16(9)12/h5-7,12,19-20H,2-4,8H2,1H3/t12-/m0/s1 |
| InChIKey | GUVKEPNWVHYXGH-LBPRGKRZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Norisodomesticine (CHEBI:169221) is a isoquinoline alkaloid (CHEBI:24921) |
| IUPAC Name |
|---|
| (12S)-19-methoxy-5,7-dioxa-13-azapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(20),2,4(8),9,16,18-hexaen-18-ol |