EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H40O3 |
| Net Charge | 0 |
| Average Mass | 328.537 |
| Monoisotopic Mass | 328.29775 |
| SMILES | CCCCCCCCC(CCCCCCCCCC(=O)O)OC |
| InChI | InChI=1S/C20H40O3/c1-3-4-5-6-10-13-16-19(23-2)17-14-11-8-7-9-12-15-18-20(21)22/h19H,3-18H2,1-2H3,(H,21,22) |
| InChIKey | ROZAZLGTUNTXFB-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 11-methoxy-nonadecanoic acid (CHEBI:169218) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| 11-methoxynonadecanoic acid |
| Manual Xrefs | Databases |
|---|---|
| LMFA01080031 | LIPID MAPS |