EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H13NO |
| Net Charge | 0 |
| Average Mass | 127.187 |
| Monoisotopic Mass | 127.09971 |
| SMILES | CC(=O)CN1CCCC1 |
| InChI | InChI=1S/C7H13NO/c1-7(9)6-8-4-2-3-5-8/h2-6H2,1H3 |
| InChIKey | YZZYFRBPGIXHPD-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-(1-Pyrrolidinyl)-2-propanone (CHEBI:169194) is a N-alkylpyrrolidine (CHEBI:46775) |
| IUPAC Name |
|---|
| 1-pyrrolidin-1-ylpropan-2-one |
| Manual Xrefs | Databases |
|---|---|
| HMDB0040030 | HMDB |
| 15018210 | ChemSpider |