EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H9NO6 |
| Net Charge | 0 |
| Average Mass | 227.172 |
| Monoisotopic Mass | 227.04299 |
| SMILES | O=C(O)CNC(=O)c1c(O)cc(O)cc1O |
| InChI | InChI=1S/C9H9NO6/c11-4-1-5(12)8(6(13)2-4)9(16)10-3-7(14)15/h1-2,11-13H,3H2,(H,10,16)(H,14,15) |
| InChIKey | OTQANJGKIPCICL-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-{[hydroxy(2,4,6-trihydroxyphenyl)methylidene]amino}acetic acid (CHEBI:169106) has functional parent N-benzoylglycine (CHEBI:18089) |
| 2-{[hydroxy(2,4,6-trihydroxyphenyl)methylidene]amino}acetic acid (CHEBI:169106) is a N-acylglycine (CHEBI:16180) |
| IUPAC Name |
|---|
| 2-[(2,4,6-trihydroxybenzoyl)amino]acetic acid |
| Manual Xrefs | Databases |
|---|---|
| 74851660 | ChemSpider |
| HMDB0125157 | HMDB |