EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H15N3O7 |
| Net Charge | 0 |
| Average Mass | 301.255 |
| Monoisotopic Mass | 301.09100 |
| SMILES | NC(CCC(=O)NC(Cn1ccc(=O)o1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C11H15N3O7/c12-6(10(17)18)1-2-8(15)13-7(11(19)20)5-14-4-3-9(16)21-14/h3-4,6-7H,1-2,5,12H2,(H,13,15)(H,17,18)(H,19,20) |
| InChIKey | XXZPYJHULCBZPT-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gamma-Glutamyl-beta-(isoxazolin-5-on-2-yl)alanine (CHEBI:169086) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| 2-amino-5-[[1-carboxy-2-(5-oxo-1,2-oxazol-2-yl)ethyl]amino]-5-oxopentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 35014953 | ChemSpider |
| HMDB0040515 | HMDB |