EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H8O7S |
| Net Charge | 0 |
| Average Mass | 260.223 |
| Monoisotopic Mass | 259.99907 |
| SMILES | O=C(O)C(=O)Cc1ccc(OS(=O)(=O)O)cc1 |
| InChI | InChI=1S/C9H8O7S/c10-8(9(11)12)5-6-1-3-7(4-2-6)16-17(13,14)15/h1-4H,5H2,(H,11,12)(H,13,14,15) |
| InChIKey | RYDYTXAKQCQRAZ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-oxo-3-[4-(sulfooxy)phenyl]propanoic acid (CHEBI:169063) has functional parent pyruvic acid (CHEBI:32816) |
| 2-oxo-3-[4-(sulfooxy)phenyl]propanoic acid (CHEBI:169063) is a 2-oxo monocarboxylic acid (CHEBI:35910) |
| IUPAC Name |
|---|
| 2-oxo-3-(4-sulooxyphenyl)propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 8282180 | ChemSpider |
| HMDB0125409 | HMDB |