EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H28N2O2 |
| Net Charge | 0 |
| Average Mass | 340.467 |
| Monoisotopic Mass | 340.21508 |
| SMILES | CCC1C2CCN3CCC4(c5cccc(OC)c5N(C(C)=O)C4C2)C13 |
| InChI | InChI=1S/C21H28N2O2/c1-4-15-14-8-10-22-11-9-21(20(15)22)16-6-5-7-17(25-3)19(16)23(13(2)24)18(21)12-14/h5-7,14-15,18,20H,4,8-12H2,1-3H3 |
| InChIKey | KNCZYJAUVPNGON-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 14,19-Dihydroaspidospermatine (CHEBI:169060) is a alkaloid (CHEBI:22315) |
| IUPAC Name |
|---|
| 1-(18-ethyl-6-methoxy-8,14-diazapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2(7),3,5-trien-8-yl)ethanone |
| Manual Xrefs | Databases |
|---|---|
| 35013184 | ChemSpider |
| HMDB0030359 | HMDB |