EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H24O12 |
| Net Charge | 0 |
| Average Mass | 552.488 |
| Monoisotopic Mass | 552.12678 |
| SMILES | COC(=O)/C(=C/c1ccc(O)c(O)c1)Oc1ccc(/C=C/C(=O)OC(Cc2ccc(O)c(O)c2)C(=O)O)cc1O |
| InChI | InChI=1S/C28H24O12/c1-38-28(37)25(14-17-3-7-19(30)21(32)12-17)39-23-8-4-15(10-22(23)33)5-9-26(34)40-24(27(35)36)13-16-2-6-18(29)20(31)11-16/h2-12,14,24,29-33H,13H2,1H3,(H,35,36)/b9-5+,25-14- |
| InChIKey | JRSJLGASDWZQGF-ILWOKKNDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Schizotenuin F (CHEBI:169046) has functional parent pyruvic acid (CHEBI:32816) |
| Schizotenuin F (CHEBI:169046) is a 2-oxo monocarboxylic acid (CHEBI:35910) |
| IUPAC Name |
|---|
| 3-(3,4-dihydroxyphenyl)-2-[(E)-3-[4-[(Z)-1-(3,4-dihydroxyphenyl)-3-methoxy-3-oxoprop-1-en-2-yl]oxy-3-hydroxyphenyl]prop-2-enoyl]oxypropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 8523023 | ChemSpider |
| HMDB0034585 | HMDB |