EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H10O |
| Net Charge | 0 |
| Average Mass | 182.222 |
| Monoisotopic Mass | 182.07316 |
| SMILES | OC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C13H10O/c14-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)13/h1-8,13-14H |
| InChIKey | AFMVESZOYKHDBJ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Alepocephalus rostratus (ncbitaxon:1245468) | - | PubMed (23398398) |
| Roles Classification |
|---|
| Biological Roles: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fluoren-9-ol (CHEBI:16904) has role animal metabolite (CHEBI:75767) |
| fluoren-9-ol (CHEBI:16904) is a hydroxyfluorenes (CHEBI:24699) |
| fluoren-9-ol (CHEBI:16904) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| 9H-fluoren-9-ol |
| Synonyms | Source |
|---|---|
| Fluoren-9-ol | KEGG COMPOUND |
| 9-Fluorenol | KEGG COMPOUND |
| 9-Hydroxyfluorene | KEGG COMPOUND |
| Diphenylene carbinol | KEGG COMPOUND |
| 9-fluorenol | ChEBI |
| 9-hydroxyfluorene | ChEBI |
| UniProt Name | Source |
|---|---|
| 9H-fluoren-9-ol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C06711 | KEGG COMPOUND |
| c0389 | UM-BBD |
| HMDB0059803 | HMDB |
| Fluorenol | Wikipedia |
| 9FLUORENOL | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| CAS:1689-64-1 | KEGG COMPOUND |
| CAS:1689-64-1 | NIST Chemistry WebBook |
| Citations |
|---|