EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H16O11S |
| Net Charge | 0 |
| Average Mass | 440.382 |
| Monoisotopic Mass | 440.04133 |
| SMILES | O=C(/C=C/c1ccc(O)c(O)c1)OC(Cc1ccc(O)c(OS(=O)(=O)O)c1)C(=O)O |
| InChI | InChI=1S/C18H16O11S/c19-12-4-1-10(7-14(12)21)3-6-17(22)28-16(18(23)24)9-11-2-5-13(20)15(8-11)29-30(25,26)27/h1-8,16,19-21H,9H2,(H,23,24)(H,25,26,27)/b6-3+ |
| InChIKey | UBKQDFBKGWYEBD-ZZXKWVIFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-{[(2E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy}-3-[4-hydroxy-3-(sulfooxy)phenyl]propanoic acid (CHEBI:169038) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| 2-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-3-(4-hydroxy-3-sulooxyphenyl)propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 74851571 | ChemSpider |
| HMDB0124966 | HMDB |