EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H23N3O8S |
| Net Charge | 0 |
| Average Mass | 393.418 |
| Monoisotopic Mass | 393.12059 |
| SMILES | CC(CSCC(NC(=O)CCC(N)C(=O)O)C(=O)NCC(=O)O)C(=O)O |
| InChI | InChI=1S/C14H23N3O8S/c1-7(13(22)23)5-26-6-9(12(21)16-4-11(19)20)17-10(18)3-2-8(15)14(24)25/h7-9H,2-6,15H2,1H3,(H,16,21)(H,17,18)(H,19,20)(H,22,23)(H,24,25) |
| InChIKey | JQWABENXVMJJMW-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gamma-L-Glutamyl-S-(2-carboxy-1-propyl)cysteinylglycine (CHEBI:168988) is a oligopeptide (CHEBI:25676) |
| IUPAC Name |
|---|
| 2-amino-5-[[1-(carboxymethylamino)-3-(2-carboxypropylsulanyl)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029394 | HMDB |
| 14764557 | ChemSpider |