EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H12NO9P3 |
| Net Charge | 0 |
| Average Mass | 299.049 |
| Monoisotopic Mass | 298.97249 |
| SMILES | O=P(O)(O)CN(CP(=O)(O)O)CP(=O)(O)O |
| InChI | InChI=1S/C3H12NO9P3/c5-14(6,7)1-4(2-15(8,9)10)3-16(11,12)13/h1-3H2,(H2,5,6,7)(H2,8,9,10)(H2,11,12,13) |
| InChIKey | YDONNITUKPKTIG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Bos taurus (ncbitaxon:9913) | |||
| spermatozoon (BTO:0001277) | MetaboLights (MTBLS1071) | Strain: Holstein-Friesian cattle [26105007] | |
| spermatozoon (FMA:67338) | MetaboLights (MTBLS1071) | Strain: Holstein-Friesian cattle [26105007] |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antiviral agent A substance that destroys or inhibits replication of viruses. EC 2.7.7.7 (DNA-directed DNA polymerase) inhibitor A DNA polymerase inhibitor that interferes with the action of a DNA-directed DNA polymerase (EC 2.7.7.7). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| [Nitrilotris(methylene)]trisphosphonic acid (CHEBI:168957) is a phosphonoacetic acid (CHEBI:15732) |
| IUPAC Name |
|---|
| [bis(phosphonomethyl)amino]methylphosphonic acid |
| Manual Xrefs | Databases |
|---|---|
| 15833 | ChemSpider |
| HMDB0029807 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:6419-19-8 | ChemIDplus |