EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H10N2O3 |
| Net Charge | 0 |
| Average Mass | 218.212 |
| Monoisotopic Mass | 218.06914 |
| SMILES | O=C(O)CNC(=O)c1cnc2ccccc12 |
| InChI | InChI=1S/C11H10N2O3/c14-10(15)6-13-11(16)8-5-12-9-4-2-1-3-7(8)9/h1-5,12H,6H2,(H,13,16)(H,14,15) |
| InChIKey | QBGTUKHXPABEHI-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-{[hydroxy(1H-indol-3-yl)methylidene]amino}acetic acid (CHEBI:168945) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| 2-(1H-indole-3-carbonylamino)acetic acid |
| Manual Xrefs | Databases |
|---|---|
| 23994542 | ChemSpider |
| HMDB0134937 | HMDB |