EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H13N3O4S |
| Net Charge | 0 |
| Average Mass | 235.265 |
| Monoisotopic Mass | 235.06268 |
| SMILES | NC(=O)CC(NC(=O)C(N)CS)C(=O)O |
| InChI | InChI=1S/C7H13N3O4S/c8-3(2-15)6(12)10-4(7(13)14)1-5(9)11/h3-4,15H,1-2,8H2,(H2,9,11)(H,10,12)(H,13,14) |
| InChIKey | AYKQJQVWUYEZNU-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cysteinyl-Asparagine (CHEBI:168943) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| 4-amino-2-[(2-amino-3-sulanylpropanoyl)amino]-4-oxobutanoic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028770 | HMDB |
| 16568279 | ChemSpider |