EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H9NO4 |
| Net Charge | 0 |
| Average Mass | 135.119 |
| Monoisotopic Mass | 135.05316 |
| SMILES | NC(C(=O)O)C(O)CO |
| InChI | InChI=1S/C4H9NO4/c5-3(4(8)9)2(7)1-6/h2-3,6-7H,1,5H2,(H,8,9) |
| InChIKey | JBNUARFQOCGDRK-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-threo-2-Amino-3,4-dihydroxybutanoic acid (CHEBI:168935) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| 2-amino-3,4-dihydroxybutanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 3137512 | ChemSpider |
| HMDB0029389 | HMDB |
| LMFA01050439 | LIPID MAPS |