EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H21N3O4 |
| Net Charge | 0 |
| Average Mass | 247.295 |
| Monoisotopic Mass | 247.15321 |
| SMILES | CC(O)C(N)C(=O)NC(CCCCN)C(=O)O |
| InChI | InChI=1S/C10H21N3O4/c1-6(14)8(12)9(15)13-7(10(16)17)4-2-3-5-11/h6-8,14H,2-5,11-12H2,1H3,(H,13,15)(H,16,17) |
| InChIKey | YKRQRPFODDJQTC-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Threoninyl-Lysine (CHEBI:168923) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| 6-amino-2-[(2-amino-3-hydroxybutanoyl)amino]hexanoic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029066 | HMDB |
| 16239835 | ChemSpider |