EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16O3 |
| Net Charge | 0 |
| Average Mass | 184.235 |
| Monoisotopic Mass | 184.10994 |
| SMILES | O=C/C=C/CCCCCCC(=O)O |
| InChI | InChI=1S/C10H16O3/c11-9-7-5-3-1-2-4-6-8-10(12)13/h5,7,9H,1-4,6,8H2,(H,12,13)/b7-5+ |
| InChIKey | YUAQBOMIASXPQW-FNORWQNLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (E)-10-Oxo-8-decenoic acid (CHEBI:168922) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (E)-10-oxodec-8-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 13402333 | ChemSpider |
| HMDB0040883 | HMDB |
| LMFA01030949 | LIPID MAPS |