EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H7N3O4 |
| Net Charge | 0 |
| Average Mass | 149.106 |
| Monoisotopic Mass | 149.04366 |
| SMILES | NC(CN[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C3H7N3O4/c4-2(3(7)8)1-5-6(9)10/h2,5H,1,4H2,(H,7,8) |
| InChIKey | QMXHUFVYJLFLRY-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3-Nitroamino)alanine (CHEBI:168916) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| 2-amino-3-nitramidopropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 32979054 | ChemSpider |
| HMDB0029398 | HMDB |