EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H50O2 |
| Net Charge | 0 |
| Average Mass | 418.706 |
| Monoisotopic Mass | 418.38108 |
| SMILES | CCCCCC/C=C\CCCCCCCCCC/C=C\CC/C=C\CCCC(=O)O |
| InChI | InChI=1S/C28H50O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-27-28(29)30/h7-8,19-20,23-24H,2-6,9-18,21-22,25-27H2,1H3,(H,29,30)/b8-7-,20-19-,24-23- |
| InChIKey | RDFXKQGVRMEZRJ-QVLUYBMUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 28:3(5Z,9Z,21Z) (CHEBI:168889) is a very long-chain fatty acid (CHEBI:27283) |
| IUPAC Name |
|---|
| (5Z,9Z,21Z)-octacosa-5,9,21-trienoic acid |
| Manual Xrefs | Databases |
|---|---|
| LMFA01030878 | LIPID MAPS |