EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H33NO2 |
| Net Charge | 0 |
| Average Mass | 271.445 |
| Monoisotopic Mass | 271.25113 |
| SMILES | CCCCCCCCCCCCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C16H33NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15(17)16(18)19/h15H,2-14,17H2,1H3,(H,18,19)/t15-/m0/s1 |
| InChIKey | XELWBYCKQCNAGY-HNNXBMFYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2S-aminohexadecanoic acid (CHEBI:168863) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| (2S)-2-aminohexadecanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4472392 | ChemSpider |
| LMFA01100017 | LIPID MAPS |