EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H43N5O6 |
| Net Charge | 0 |
| Average Mass | 605.736 |
| Monoisotopic Mass | 605.32133 |
| SMILES | COc1ccc2cc1/C=C/NC(=O)C(Cc1ccccc1)NC(=O)C1C(CCN1C(=O)C(NC(=O)C(C)N(C)C)C(C)C)O2 |
| InChI | InChI=1S/C33H43N5O6/c1-20(2)28(36-30(39)21(3)37(4)5)33(42)38-17-15-27-29(38)32(41)35-25(18-22-10-8-7-9-11-22)31(40)34-16-14-23-19-24(44-27)12-13-26(23)43-6/h7-14,16,19-21,25,27-29H,15,17-18H2,1-6H3,(H,34,40)(H,35,41)(H,36,39)/b16-14+ |
| InChIKey | KLYKBXVHBJWDJF-JQIJEIRASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Amphibine H (CHEBI:168861) is a oligopeptide (CHEBI:25676) |
| IUPAC Name |
|---|
| N-[1-[(13E)-10-benzyl-16-methoxy-8,11-dioxo-2-oxa-6,9,12-triazatricyclo[13.3.1.03,7]nonadeca-1(19),13,15,17-tetraen-6-yl]-3-methyl-1-oxobutan-2-yl]-2-(dimethylamino)propanamide |
| Manual Xrefs | Databases |
|---|---|
| 35032851 | ChemSpider |
| HMDB0029333 | HMDB |