EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H13NO5 |
| Net Charge | 0 |
| Average Mass | 239.227 |
| Monoisotopic Mass | 239.07937 |
| SMILES | COc1cc(OC)cc(C(=O)NCC(=O)O)c1 |
| InChI | InChI=1S/C11H13NO5/c1-16-8-3-7(4-9(5-8)17-2)11(15)12-6-10(13)14/h3-5H,6H2,1-2H3,(H,12,15)(H,13,14) |
| InChIKey | UFBSPOIKQBQXCT-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-{[(3,5-dimethoxyphenyl)(hydroxy)methylidene]amino}acetic acid (CHEBI:168859) has functional parent N-benzoylglycine (CHEBI:18089) |
| 2-{[(3,5-dimethoxyphenyl)(hydroxy)methylidene]amino}acetic acid (CHEBI:168859) is a N-acylglycine (CHEBI:16180) |
| IUPAC Name |
|---|
| 2-[(3,5-dimethoxybenzoyl)amino]acetic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0131468 | HMDB |
| 1781075 | ChemSpider |