EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H22O9S |
| Net Charge | 0 |
| Average Mass | 438.454 |
| Monoisotopic Mass | 438.09845 |
| SMILES | COc1cc2ccc1Oc1cc(ccc1O)C(O)CC(=O)CCCC2OS(=O)(=O)O |
| InChI | InChI=1S/C20H22O9S/c1-27-20-10-13-6-8-18(20)28-19-9-12(5-7-15(19)22)16(23)11-14(21)3-2-4-17(13)29-30(24,25)26/h5-10,16-17,22-23H,2-4,11H2,1H3,(H,24,25,26) |
| InChIKey | BIRQPSIYIVPSPT-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| {4,8-dihydroxy-17-methoxy-10-oxo-2-oxatricyclo[13.2.2.1?,?]icosa-1(17),3,5,7(20),15,18-hexaen-14-yl}oxidanesulfonic acid (CHEBI:168856) is a diarylheptanoid (CHEBI:78802) |
| IUPAC Name |
|---|
| (4,8-dihydroxy-17-methoxy-10-oxo-2-oxatricyclo[13.2.2.13,7]icosa-1(17),3,5,7(20),15,18-hexaen-14-yl) hydrogen sulate |
| Manual Xrefs | Databases |
|---|---|
| 74853288 | ChemSpider |
| HMDB0133431 | HMDB |