EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H32O5 |
| Net Charge | 0 |
| Average Mass | 328.449 |
| Monoisotopic Mass | 328.22497 |
| SMILES | CCCCCC1OC1C(/C=C/CCCCCCCC(=O)O)OO |
| InChI | InChI=1S/C18H32O5/c1-2-3-9-12-15-18(22-15)16(23-21)13-10-7-5-4-6-8-11-14-17(19)20/h10,13,15-16,18,21H,2-9,11-12,14H2,1H3,(H,19,20)/b13-10+ |
| InChIKey | LSLYTZURYMOJBX-JLHYYAGUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 11-hydroperoxy-12,13-epoxy-9-octadecenoic acid (CHEBI:168840) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| (E)-11-hydroperoxy-11-(3-pentyloxiran-2-yl)undec-9-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4445989 | ChemSpider |
| LMFA01040011 | LIPID MAPS |