EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H24O11 |
| Net Charge | 0 |
| Average Mass | 404.368 |
| Monoisotopic Mass | 404.13186 |
| SMILES | C/C=C1/[C@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)OC=C(C(=O)OC)[C@H]1CC(=O)O |
| InChI | InChI=1S/C17H24O11/c1-3-7-8(4-11(19)20)9(15(24)25-2)6-26-16(7)28-17-14(23)13(22)12(21)10(5-18)27-17/h3,6,8,10,12-14,16-18,21-23H,4-5H2,1-2H3,(H,19,20)/b7-3+/t8-,10+,12+,13-,14+,16-,17-/m0/s1 |
| InChIKey | XSCVKBFEPYGZSL-JYVCFIOWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Rattus norvegicus (ncbitaxon:10116) | blood plasma (BTO:0000118) | PubMed (32864882) | |
| Olea europaea (ncbitaxon:4146) | - | PubMed (31523827) | |
| Osmanthus fragrans (ncbitaxon:93977) | - | DOI (10.1016/j.sajb.2015.03.180) | Isolated from pulp. |
| Jasminum tortuosum (ncbitaxon:1548298) | bark (BTO:0001301) | PubMed (29140106) | Isolated from stem bark. |
| Syringa vulgaris (ncbitaxon:34270) | flower (BTO:0000469) | PubMed (28728914) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oleoside 11-methyl ester (CHEBI:168822) has role plant metabolite (CHEBI:76924) |
| oleoside 11-methyl ester (CHEBI:168822) is a dicarboxylic acid monoester (CHEBI:36244) |
| oleoside 11-methyl ester (CHEBI:168822) is a enoate ester (CHEBI:51702) |
| oleoside 11-methyl ester (CHEBI:168822) is a methyl ester (CHEBI:25248) |
| oleoside 11-methyl ester (CHEBI:168822) is a monosaccharide derivative (CHEBI:63367) |
| oleoside 11-methyl ester (CHEBI:168822) is a pyrans (CHEBI:26407) |
| oleoside 11-methyl ester (CHEBI:168822) is a secoiridoid glycoside (CHEBI:50274) |
| oleoside 11-methyl ester (CHEBI:168822) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| [(2S,3E,4S)-3-ethylidene-2-(β-D-glucopyranosyloxy)-5-(methoxycarbonyl)-3,4-dihydro-2H-pyran-4-yl]acetic acid |
| Synonyms | Source |
|---|---|
| 11-methyloleoside | ChEBI |
| methyloleoside | ChEBI |
| (−)-oleoside 11-methyl ester | KNApSAcK |
| Manual Xrefs | Databases |
|---|---|
| 8867908 | ChemSpider |
| FDB021533 | FooDB |
| C00037580 | KNApSAcK |
| HMDB0041550 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:60539-23-3 | KNApSAcK |
| Citations |
|---|