EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H12NO8P |
| Net Charge | 0 |
| Average Mass | 269.146 |
| Monoisotopic Mass | 269.03005 |
| SMILES | CC(=O)N[C@@H](CCC(=O)OP(=O)(O)O)C(=O)O |
| InChI | InChI=1S/C7H12NO8P/c1-4(9)8-5(7(11)12)2-3-6(10)16-17(13,14)15/h5H,2-3H2,1H3,(H,8,9)(H,11,12)(H2,13,14,15)/t5-/m0/s1 |
| InChIKey | FCVIHFVSXHOPSW-YFKPBYRVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) |
| Roles Classification |
|---|
| Biological Role: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-acetyl-L-γ-glutamyl phosphate (CHEBI:16878) has functional parent L-γ-glutamyl phosphate (CHEBI:17798) |
| N-acetyl-L-γ-glutamyl phosphate (CHEBI:16878) has role Escherichia coli metabolite (CHEBI:76971) |
| N-acetyl-L-γ-glutamyl phosphate (CHEBI:16878) is a L-glutamic acid derivative (CHEBI:83982) |
| N-acetyl-L-γ-glutamyl phosphate (CHEBI:16878) is conjugate acid of N-acetyl-L-γ-glutamyl phosphate(3−) (CHEBI:57936) |
| Incoming Relation(s) |
| N-acetyl-L-γ-glutamyl phosphate(3−) (CHEBI:57936) is conjugate base of N-acetyl-L-γ-glutamyl phosphate (CHEBI:16878) |
| IUPAC Name |
|---|
| (2S)-2-acetamido-5-oxo-5-(phosphonooxy)pentanoic acid |
| Synonyms | Source |
|---|---|
| N-acetyl-5-oxo-5-(phosphonooxy)-L-norvaline | ChEBI |
| N-acetyl-5-glutamyl phosphate | ChEBI |
| N-acetyl-L-glutamate 5-phosphate | ChEBI |
| N-Acetyl-L-glutamate 5-phosphate | KEGG COMPOUND |
| N-acetyl-L-glutamyl 5-phosphate | ChEBI |
| N-Acetyl-L-glutamyl 5-phosphate | KEGG COMPOUND |