EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16O4 |
| Net Charge | 0 |
| Average Mass | 200.234 |
| Monoisotopic Mass | 200.10486 |
| SMILES | CC(=O)CCC(=O)CCCCC(=O)O |
| InChI | InChI=1S/C10H16O4/c1-8(11)6-7-9(12)4-2-3-5-10(13)14/h2-7H2,1H3,(H,13,14) |
| InChIKey | BEPSZXZHUPDOJB-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6,9-dioxo-decanoic acid (CHEBI:168776) is a oxo carboxylic acid (CHEBI:25754) |
| IUPAC Name |
|---|
| 6,9-dioxodecanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4472306 | ChemSpider |
| LMFA01060080 | LIPID MAPS |