EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H34O5 |
| Net Charge | 0 |
| Average Mass | 330.465 |
| Monoisotopic Mass | 330.24062 |
| SMILES | CCCCCCC(O)C/C=C/C(O)CCC(O)CCCC(=O)O |
| InChI | InChI=1S/C18H34O5/c1-2-3-4-5-8-15(19)9-6-10-16(20)13-14-17(21)11-7-12-18(22)23/h6,10,15-17,19-21H,2-5,7-9,11-14H2,1H3,(H,22,23)/b10-6+ |
| InChIKey | LGADJSRSYLFTSG-UXBLZVDNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5,8,12-trihydroxy-9-octadecenoic acid (CHEBI:168756) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| (E)-5,8,12-trihydroxyoctadec-9-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4472302 | ChemSpider |
| HMDB0030936 | HMDB |
| LMFA01050336 | LIPID MAPS |