EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H30O14 |
| Net Charge | 0 |
| Average Mass | 518.468 |
| Monoisotopic Mass | 518.16356 |
| SMILES | COc1cc(/C=C/C(=O)OC2C(OCC3OC(O)C(O)C(O)C3O)OC(CO)C(O)C2O)ccc1O |
| InChI | InChI=1S/C22H30O14/c1-32-11-6-9(2-4-10(11)24)3-5-14(25)36-20-18(29)15(26)12(7-23)35-22(20)33-8-13-16(27)17(28)19(30)21(31)34-13/h2-6,12-13,15-24,26-31H,7-8H2,1H3/b5-3+ |
| InChIKey | UJMDJSLNJNWYGD-HWKANZROSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4,5-dihydroxy-6-(hydroxymethyl)-2-[(3,4,5,6-tetrahydroxyoxan-2-yl)methoxy]oxan-3-yl 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate (CHEBI:168752) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| [4,5-dihydroxy-6-(hydroxymethyl)-2-[(3,4,5,6-tetrahydroxyoxan-2-yl)methoxy]oxan-3-yl] (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |