EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H27N3O12S |
| Net Charge | 0 |
| Average Mass | 593.567 |
| Monoisotopic Mass | 593.13154 |
| SMILES | NC(CCC(=O)NC(CSc1c(O)c(O)c(O)c(C(=O)/C=C/c2ccc(O)cc2)c1O)C(=O)NCC(=O)O)C(=O)O |
| InChI | InChI=1S/C25H27N3O12S/c26-13(25(39)40)6-8-16(31)28-14(24(38)27-9-17(32)33)10-41-23-20(35)18(19(34)21(36)22(23)37)15(30)7-3-11-1-4-12(29)5-2-11/h1-5,7,13-14,29,34-37H,6,8-10,26H2,(H,27,38)(H,28,31)(H,32,33)(H,39,40)/b7-3+ |
| InChIKey | BBQSCWJFXGSQHB-XVNBXDOJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-amino-4-({1-[(carboxymethyl)-C-hydroxycarbonimidoyl]-2-({2,3,4,6-tetrahydroxy-5-[(2E)-3-(4-hydroxyphenyl)prop-2-enoyl]phenyl}sulfanyl)ethyl}-C-hydroxycarbonimidoyl)butanoic acid (CHEBI:168705) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| 2-amino-5-[[1-(carboxymethylamino)-1-oxo-3-[2,3,4,6-tetrahydroxy-5-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]phenyl]sulanylpropan-2-yl]amino]-5-oxopentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 74851958 | ChemSpider |
| HMDB0126628 | HMDB |