EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H24N4O3 |
| Net Charge | 0 |
| Average Mass | 284.360 |
| Monoisotopic Mass | 284.18484 |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H]1CCCN1)C(=O)NCC(N)=O |
| InChI | InChI=1S/C13H24N4O3/c1-8(2)6-10(12(19)16-7-11(14)18)17-13(20)9-4-3-5-15-9/h8-10,15H,3-7H2,1-2H3,(H2,14,18)(H,16,19)(H,17,20)/t9-,10-/m0/s1 |
| InChIKey | NOOJLZTTWSNHOX-UWVGGRQHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Melanostatin (CHEBI:168693) is a oligopeptide (CHEBI:25676) |
| IUPAC Name |
|---|
| (2S)-N-[(2S)-1-[(2-amino-2-oxoethyl)amino]-4-methyl-1-oxopentan-2-yl]pyrrolidine-2-carboxamide |
| Manual Xrefs | Databases |
|---|---|
| 83871 | ChemSpider |
| HMDB0005764 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:2002-44-0 | ChemIDplus |