EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H54O12 |
| Net Charge | 0 |
| Average Mass | 678.816 |
| Monoisotopic Mass | 678.36153 |
| SMILES | CC(=O)OC1CC(OC2OC(CO)C(O)C(O)C2O)CC2=CCC3C(CCC4(C)C(C(C)(O)C5CC(C)=C(C)C(=O)O5)CCC34O)C21C |
| InChI | InChI=1S/C36H54O12/c1-17-13-27(48-31(42)18(17)2)35(6,43)25-10-12-36(44)23-8-7-20-14-21(46-32-30(41)29(40)28(39)24(16-37)47-32)15-26(45-19(3)38)34(20,5)22(23)9-11-33(25,36)4/h7,21-30,32,37,39-41,43-44H,8-16H2,1-6H3 |
| InChIKey | ACXRDVCAKSUCPM-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-Acetyl-3,14,20-trihydroxywitha-5,24-dienolide 3-glucoside (CHEBI:168690) is a glycoside (CHEBI:24400) |
| 1-Acetyl-3,14,20-trihydroxywitha-5,24-dienolide 3-glucoside (CHEBI:168690) is a withanolide (CHEBI:74716) |
| IUPAC Name |
|---|
| [17-[1-(4,5-dimethyl-6-oxo-2,3-dihydropyran-2-yl)-1-hydroxyethyl]-14-hydroxy-10,13-dimethyl-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,2,3,4,7,8,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-1-yl] acetate |
| Manual Xrefs | Databases |
|---|---|
| HMDB0033572 | HMDB |