EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H14N2O5 |
| Net Charge | 0 |
| Average Mass | 254.242 |
| Monoisotopic Mass | 254.09027 |
| SMILES | NC(CCC(=O)Nc1ccc(O)c(O)c1)C(=O)O |
| InChI | InChI=1S/C11H14N2O5/c12-7(11(17)18)2-4-10(16)13-6-1-3-8(14)9(15)5-6/h1,3,5,7,14-15H,2,4,12H2,(H,13,16)(H,17,18) |
| InChIKey | HJLNKWYSKFDHDG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-Agaridoxin (CHEBI:168667) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| 2-amino-5-(3,4-dihydroxyanilino)-5-oxopentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029445 | HMDB |
| 35032872 | ChemSpider |