EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H34N4O6 |
| Net Charge | 0 |
| Average Mass | 402.492 |
| Monoisotopic Mass | 402.24783 |
| SMILES | NC(CCC/C=C(\CCC(N)C(=O)O)CNCCCCC(N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C18H34N4O6/c19-13(16(23)24)6-2-1-5-12(8-9-15(21)18(27)28)11-22-10-4-3-7-14(20)17(25)26/h5,13-15,22H,1-4,6-11,19-21H2,(H,23,24)(H,25,26)(H,27,28)/b12-5+ |
| InChIKey | ZUXGPPMNMKSOEO-LFYBBSHMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Merodesmosine (CHEBI:168656) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| (E)-2,10-diamino-5-[[(5-amino-5-carboxypentyl)amino]methyl]undec-5-enedioic acid |
| Manual Xrefs | Databases |
|---|---|
| 35013192 | ChemSpider |
| HMDB0030407 | HMDB |