EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H10O3 |
| Net Charge | 0 |
| Average Mass | 118.132 |
| Monoisotopic Mass | 118.06299 |
| SMILES | C[C@@H](O)[C@@H](C)C(=O)O |
| InChI | InChI=1S/C5H10O3/c1-3(4(2)6)5(7)8/h3-4,6H,1-2H3,(H,7,8)/t3-,4-/m1/s1 |
| InChIKey | VEXDRERIMPLZLU-QWWZWVQMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-Hydroxy-2-methyl-[S-(R,R)]-butanoic acid (CHEBI:168648) is a hydroxy fatty acid (CHEBI:24654) |
| IUPAC Name |
|---|
| (2R,3R)-3-hydroxy-2-methylbutanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 13628080 | ChemSpider |
| LMFA01050492 | LIPID MAPS |
| HMDB0000410 | HMDB |