EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H36O3 |
| Net Charge | 0 |
| Average Mass | 300.483 |
| Monoisotopic Mass | 300.26645 |
| SMILES | CC(O)CCCCCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C18H36O3/c1-17(19)15-13-11-9-7-5-3-2-4-6-8-10-12-14-16-18(20)21/h17,19H,2-16H2,1H3,(H,20,21) |
| InChIKey | CKGPXFKOAGKQDN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 17-hydroxy stearic acid (CHEBI:168647) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| 17-hydroxyoctadecanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4446041 | ChemSpider |
| LMFA01050069 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:4552-19-6 | ChemIDplus |